List of polar and nonpolar molecules
A source-backed list of polar molecules, nonpolar molecules, and common polar bond examples with transparent classification notes.
| Name | Formula | MW (g/mol) | Classification | Basis | SMILES | PubChem CID | |
|---|---|---|---|---|---|---|---|
| Water | H2O | 18.02 | Polar molecule | Bent geometry and polar O-H bonds | O | 962 | |
| Ammonia | NH3 | 17.03 | Polar molecule | Trigonal pyramidal geometry | N | 222 | |
| Hydrogen fluoride | HF | 20.01 | Polar molecule | Strongly polar H-F bond | F | 14917 | |
| Ethanol | C2H6O | 46.07 | Polar molecule | Hydroxyl group and hydrogen bonding | CCO | 702 | |
| Acetone | C3H6O | 58.08 | Polar molecule | Carbonyl group | CC(=O)C | 180 | |
| Carbon dioxide | CO2 | 44.01 | Nonpolar molecule | Linear symmetric molecule | O=C=O | 280 | |
| Methane | CH4 | 16.04 | Nonpolar molecule | Tetrahedral symmetric hydrocarbon | C | 297 | |
| Oxygen | O2 | 32.00 | Nonpolar molecule | Homonuclear diatomic molecule | O=O | 977 | |
| n-Hexane | C6H14 | 86.18 | Nonpolar molecule | Hydrocarbon | CCCCCC | 8058 | |
| Benzene | C6H6 | 78.11 | Nonpolar molecule | Symmetric aromatic hydrocarbon | c1ccccc1 | 241 | |
| Methanol | CH4O | 32.04 | Polar molecule | Hydroxyl group and hydrogen bonding | CO | 887 | |
| Hydrogen chloride | HCl | 36.46 | Polar molecule | Polar H-Cl bond | Cl | 313 | |
| Sulfur dioxide | SO2 | 64.06 | Polar molecule | Bent geometry | O=S=O | 1119 | |
| Dimethyl sulfoxide | C2H6OS | 78.13 | Polar molecule | Sulfoxide group | CS(=O)C | 679 | |
| Acetonitrile | C2H3N | 41.05 | Polar molecule | Nitrile group | CC#N | 6342 | |
| Nitrogen | N2 | 28.01 | Nonpolar molecule | Homonuclear diatomic molecule | N#N | 947 | |
| Chlorine | Cl2 | 70.90 | Nonpolar molecule | Homonuclear diatomic molecule | ClCl | 24526 | |
| Carbon tetrachloride | CCl4 | 153.81 | Nonpolar molecule | Symmetric tetrahedral molecule | C(Cl)(Cl)(Cl)Cl | 5943 | |
| Cyclohexane | C6H12 | 84.16 | Nonpolar molecule | Hydrocarbon | C1CCCCC1 | 8078 | |
| Formamide | CH3NO | 45.04 | Polar molecule | Amide group | C(=O)N | 713 | |
| Dimethylformamide | C3H7NO | 73.10 | Polar molecule | Amide solvent | CN(C)C=O | 6228 | |
| Formic acid | CH2O2 | 46.03 | Polar molecule | Carboxylic acid | C(=O)O | 284 | |
| Acetic acid | C2H4O2 | 60.05 | Polar molecule | Carboxylic acid | CC(=O)O | 176 | |
| Formaldehyde | CH2O | 30.03 | Polar molecule | Carbonyl group | C=O | 712 | |
| Acetaldehyde | C2H4O | 44.05 | Polar molecule | Aldehyde group | CC=O | 177 | |
| Hydrogen cyanide | HCN | 27.03 | Polar molecule | Polar C-N triple bond | C#N | 768 | |
| Nitric oxide | NO | 30.01 | Polar molecule | Heteronuclear diatomic molecule | [N]=O | 145068 | |
| Nitromethane | CH3NO2 | 61.04 | Polar molecule | Nitro group | C[N+](=O)[O-] | 6375 | |
| Methylamine | CH5N | 31.06 | Polar molecule | Amine group | CN | 6329 | |
| Ethylamine | C2H7N | 45.09 | Polar molecule | Amine group | CCN | 6341 | |
| Diethyl ether | C4H10O | 74.12 | Polar molecule | Ether oxygen | CCOCC | 3283 | |
| Sulfur hexafluoride | SF6 | 146.05 | Nonpolar molecule | Octahedral symmetric molecule | FS(F)(F)(F)(F)F | 17358 | |
| Boron trifluoride | BF3 | 67.80 | Nonpolar molecule | Trigonal planar symmetric molecule | B(F)(F)F | 6356 | |
| Tetrachloroethylene | C2Cl4 | 165.82 | Nonpolar molecule | Symmetric chlorinated alkene | C(=C(Cl)Cl)(Cl)Cl | 31373 | |
| Ethane | C2H6 | 30.07 | Nonpolar molecule | Hydrocarbon | CC | 6324 | |
| Propane | C3H8 | 44.10 | Nonpolar molecule | Hydrocarbon | CCC | 6334 | |
| Ethene | C2H4 | 28.05 | Nonpolar molecule | Hydrocarbon | C=C | 6325 | |
| Acetylene | C2H2 | 26.04 | Nonpolar molecule | Linear hydrocarbon | C#C | 6326 | |
| Fluorine | F2 | 38.00 | Nonpolar molecule | Homonuclear diatomic molecule | FF | 24524 | |
| Bromine | Br2 | 159.81 | Nonpolar molecule | Homonuclear diatomic molecule | BrBr | 24408 | |
| Iodine | I2 | 253.80 | Nonpolar molecule | Homonuclear diatomic molecule | II | 807 | |
| Hydrogen Bromide | BrH | 80.91 | Polar molecule | Functional groups or geometry create a net dipole | Br | 260 | |
| Hydrogen Iodide | HI | 127.91 | Polar molecule | Functional groups or geometry create a net dipole | I | 24841 | |
| Hydrogen Sulfide | H2S | 34.08 | Polar molecule | Functional groups or geometry create a net dipole | S | 402 | |
| 1-Propanol | C3H8O | 60.10 | Polar molecule | Functional groups or geometry create a net dipole | CCCO | 1031 | |
| Isopropanol | C3H8O | 60.10 | Polar molecule | Functional groups or geometry create a net dipole | CC(C)O | 3776 | |
| 1-Butanol | C4H10O | 74.12 | Polar molecule | Functional groups or geometry create a net dipole | CCCCO | 263 | |
| Ethylene Glycol | C2H6O2 | 62.07 | Polar molecule | Functional groups or geometry create a net dipole | C(CO)O | 174 | |
| Glycerol | C3H8O3 | 92.09 | Polar molecule | Functional groups or geometry create a net dipole | C(C(CO)O)O | 753 | |
| Butanone | C4H8O | 72.11 | Polar molecule | Functional groups or geometry create a net dipole | CCC(=O)C | 6569 | |
| Propionic Acid | C3H6O2 | 74.08 | Polar molecule | Functional groups or geometry create a net dipole | CCC(=O)O | 1032 | |
| Lactic Acid | C3H6O3 | 90.08 | Polar molecule | Functional groups or geometry create a net dipole | CC(C(=O)O)O | 612 | |
| Citric Acid | C6H8O7 | 192.12 | Polar molecule | Functional groups or geometry create a net dipole | C(C(=O)O)C(CC(=O)O)(C(=O)O)O | 311 | |
| Urea | CH4N2O | 60.06 | Polar molecule | Functional groups or geometry create a net dipole | C(=O)(N)N | 1176 | |
| Aniline | C6H7N | 93.13 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC=C(C=C1)N | 6115 | |
| Pyridine | C5H5N | 79.10 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC=NC=C1 | 1049 | |
| Phenol | C6H6O | 94.11 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC=C(C=C1)O | 996 | |
| Glucose | C6H12O6 | 180.16 | Polar molecule | Functional groups or geometry create a net dipole | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O | 5793 | |
| Fructose | C6H12O6 | 180.16 | Polar molecule | Functional groups or geometry create a net dipole | C1[C@H]([C@H]([C@@H](C(O1)(CO)O)O)O)O | 2723872 | |
| Sucrose | C12H22O11 | 342.30 | Polar molecule | Functional groups or geometry create a net dipole | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO)O)O)O)O | 5988 | |
| Glycine | C2H5NO2 | 75.07 | Polar molecule | Functional groups or geometry create a net dipole | C(C(=O)O)N | 750 | |
| Alanine | C3H7NO2 | 89.09 | Polar molecule | Functional groups or geometry create a net dipole | C[C@@H](C(=O)O)N | 5950 | |
| Serine | C3H7NO3 | 105.09 | Polar molecule | Functional groups or geometry create a net dipole | C([C@@H](C(=O)O)N)O | 5951 | |
| Lysine | C6H14N2O2 | 146.19 | Polar molecule | Functional groups or geometry create a net dipole | C(CCN)C[C@@H](C(=O)O)N | 5962 | |
| Aspartic Acid | C4H7NO4 | 133.10 | Polar molecule | Functional groups or geometry create a net dipole | C([C@@H](C(=O)O)N)C(=O)O | 5960 | |
| Glutamic Acid | C5H9NO4 | 147.13 | Polar molecule | Functional groups or geometry create a net dipole | C(CC(=O)O)[C@@H](C(=O)O)N | 33032 | |
| Dopamine | C8H11NO2 | 153.18 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC(=C(C=C1CCN)O)O | 681 | |
| Serotonin | C10H12N2O | 176.22 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC2=C(C=C1O)C(=CN2)CCN | 5202 | |
| Caffeine | C8H10N4O2 | 194.19 | Polar molecule | Functional groups or geometry create a net dipole | CN1C=NC2=C1C(=O)N(C(=O)N2C)C | 2519 | |
| Tetrahydrofuran | C4H8O | 72.11 | Polar molecule | Functional groups or geometry create a net dipole | C1CCOC1 | 8028 | |
| Dioxane | C4H8O2 | 88.11 | Polar molecule | Functional groups or geometry create a net dipole | C1COCCO1 | 31275 | |
| Morpholine | C4H9NO | 87.12 | Polar molecule | Functional groups or geometry create a net dipole | C1COCCN1 | 8083 | |
| Piperidine | C5H11N | 85.15 | Polar molecule | Functional groups or geometry create a net dipole | C1CCNCC1 | 8082 | |
| Piperazine | C4H10N2 | 86.14 | Polar molecule | Functional groups or geometry create a net dipole | C1CNCCN1 | 4837 | |
| Sulfolane | C4H8O2S | 120.17 | Polar molecule | Functional groups or geometry create a net dipole | C1CCS(=O)(=O)C1 | 31347 | |
| Hydrogen Peroxide | H2O2 | 34.01 | Polar molecule | Functional groups or geometry create a net dipole | OO | 784 | |
| Sulfuric Acid | H2O4S | 98.07 | Polar molecule | Functional groups or geometry create a net dipole | OS(=O)(=O)O | 1118 | |
| Nitric Acid | HNO3 | 63.01 | Polar molecule | Functional groups or geometry create a net dipole | [N+](=O)(O)[O-] | 944 | |
| Phosphoric Acid | H3O4P | 97.99 | Polar molecule | Functional groups or geometry create a net dipole | OP(=O)(O)O | 1004 | |
| Sodium Hydroxide | HNaO | 40.00 | Polar molecule | Functional groups or geometry create a net dipole | [OH-].[Na+] | 14798 | |
| Potassium Hydroxide | HKO | 56.11 | Polar molecule | Functional groups or geometry create a net dipole | [OH-].[K+] | 14797 | |
| Sodium Bicarbonate | CHNaO3 | 84.01 | Polar molecule | Functional groups or geometry create a net dipole | C(=O)(O)[O-].[Na+] | 516892 | |
| Salicylic Acid | C7H6O3 | 138.12 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC=C(C(=C1)C(=O)O)O | 338 | |
| Benzoic Acid | C7H6O2 | 122.12 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC=C(C=C1)C(=O)O | 243 | |
| Vanillin | C8H8O3 | 152.15 | Polar molecule | Functional groups or geometry create a net dipole | COC1=C(C=CC(=C1)C=O)O | 1183 | |
| Menthol | C10H20O | 156.27 | Polar molecule | Functional groups or geometry create a net dipole | CC1CCC(C(C1)O)C(C)C | 1254 | |
| Nicotine | C10H14N2 | 162.24 | Polar molecule | Functional groups or geometry create a net dipole | CN1CCC[C@H]1C2=CN=CC=C2 | 89594 | |
| Acetaminophen | C8H9NO2 | 151.17 | Polar molecule | Functional groups or geometry create a net dipole | CC(=O)NC1=CC=C(C=C1)O | 1983 | |
| Aspirin | C9H8O4 | 180.16 | Polar molecule | Functional groups or geometry create a net dipole | CC(=O)OC1=CC=CC=C1C(=O)O | 2244 | |
| Morphine | C17H19NO3 | 285.34 | Polar molecule | Functional groups or geometry create a net dipole | CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3[C@H](C=C4)O | 5288826 | |
| Lidocaine | C14H22N2O | 234.34 | Polar molecule | Functional groups or geometry create a net dipole | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C | 3676 | |
| Epinephrine | C9H13NO3 | 183.21 | Polar molecule | Functional groups or geometry create a net dipole | CNC[C@@H](C1=CC(=C(C=C1)O)O)O | 5816 | |
| Norepinephrine | C8H11NO3 | 169.18 | Polar molecule | Functional groups or geometry create a net dipole | C1=CC(=C(C=C1[C@H](CN)O)O)O | 439260 | |
| Histamine | C5H9N3 | 111.15 | Polar molecule | Functional groups or geometry create a net dipole | C1=C(NC=N1)CCN | 774 | |
| Acetylcholine | C7H16NO2+ | 146.21 | Polar molecule | Functional groups or geometry create a net dipole | CC(=O)OCC[N+](C)(C)C | 187 | |
| Gamma-Aminobutyric Acid | C4H9NO2 | 103.12 | Polar molecule | Functional groups or geometry create a net dipole | C(CC(=O)O)CN | 119 | |
| Taurine | C2H7NO3S | 125.14 | Polar molecule | Functional groups or geometry create a net dipole | C(CS(=O)(=O)O)N | 1123 | |
| Creatine | C4H9N3O2 | 131.14 | Polar molecule | Functional groups or geometry create a net dipole | CN(CC(=O)O)C(=N)N | 586 | |
| Creatinine | C4H7N3O | 113.12 | Polar molecule | Functional groups or geometry create a net dipole | CN1CC(=O)N=C1N | 588 | |
| Uric Acid | C5H4N4O3 | 168.11 | Polar molecule | Functional groups or geometry create a net dipole | C12=C(NC(=O)N1)NC(=O)NC2=O | 1175 |
Methodology
Small inorganic examples are manually classified from molecular geometry and bond polarity. Organic examples use functional groups, hydrogen bonding, TPSA, and LogP as supporting evidence; borderline cases keep explicit notes.
Sources
PubChem
Canonical compound identifiers, names, formulas, structures, SMILES, and downloadable compound records.
ChEBI
Chemical ontology classes, biological roles, synonyms, formulas, SMILES, InChI, and ChEBI identifiers.
RDKit
Derived descriptors such as molecular weight, LogP, TPSA, hydrogen-bond counts, and canonicalized structures.
OpenStax Chemistry
Chemistry definitions used for educational polarity, bonding, organic chemistry, and molecule-class explanations.